C21H23FN4O5S2 — CID 89259788
[(5R)-3-[4-[4-[cyano(1,3-thiazol-2-yl)methyl]piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 89259788) has the molecular formula C21H23FN4O5S2 and a molecular weight of 494.57 g/mol. Its IUPAC name is [(5R)-3-[4-[4-[cyano(1,3-thiazol-2-yl)methyl]piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-[4-[4-[cyano(1,3-thiazol-2-yl)methyl]piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 89259788 |
| Molecular Formula | C21H23FN4O5S2 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | [(5R)-3-[4-[4-[cyano(1,3-thiazol-2-yl)methyl]piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1CN(c2ccc(N3CCC(C(C#N)c4nccs4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H23FN4O5S2/c1-33(28,29)30-13-16-12-26(21(27)31-16)15-2-3-19(18(22)10-15)25-7-4-14(5-8-25)17(11-23)20-24-6-9-32-20/h2-3,6,9-10,14,16-17H,4-5,7-8,12-13H2,1H3/t16-,17?/m1/s1 |
| InChIKey | LAQNGMOJAAWBTN-TZHYSIJRSA-N |
| XLogP | 3.11 |
| TPSA | 112.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|