C21H25FN4O6S — CID 163916031
[(5R)-3-[4-[4-(2-amino-1-cyano-2-oxoethyl)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl prop-1-ene-2-sulfonate (PubChem CID 163916031) has the molecular formula C21H25FN4O6S and a molecular weight of 480.52 g/mol. Its IUPAC name is [(5R)-3-[4-[4-(2-amino-1-cyano-2-oxoethyl)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl prop-1-ene-2-sulfonate.
| Compound Name | [(5R)-3-[4-[4-(2-amino-1-cyano-2-oxoethyl)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl prop-1-ene-2-sulfonate |
|---|---|
| PubChem CID | 163916031 |
| Molecular Formula | C21H25FN4O6S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [(5R)-3-[4-[4-(2-amino-1-cyano-2-oxoethyl)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl prop-1-ene-2-sulfonate |
| SMILES | C=C(C)S(=O)(=O)OC[C@H]1CN(c2ccc(N3CCC(C(C#N)C(N)=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H25FN4O6S/c1-13(2)33(29,30)31-12-16-11-26(21(28)32-16)15-3-4-19(18(22)9-15)25-7-5-14(6-8-25)17(10-23)20(24)27/h3-4,9,14,16-17H,1,5-8,11-12H2,2H3,(H2,24,27)/t16-,17?/m1/s1 |
| InChIKey | QWHQKZLUUVOOQZ-TZHYSIJRSA-N |
| XLogP | 1.87 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|