C18H20F2N2O4S — CID 147401622
(5S)-3-[3,5-difluoro-4-(2-oxo-2λ4-thia-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 147401622) has the molecular formula C18H20F2N2O4S and a molecular weight of 398.43 g/mol. Its IUPAC name is (5S)-3-[3,5-difluoro-4-(2-oxo-2λ4-thia-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3,5-difluoro-4-(2-oxo-2λ4-thia-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 147401622 |
| Molecular Formula | C18H20F2N2O4S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (5S)-3-[3,5-difluoro-4-(2-oxo-2λ4-thia-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2cc(F)c(N3CC4(C3)CS(=O)C4)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H20F2N2O4S/c1-11(23)2-3-13-6-22(17(24)26-13)12-4-14(19)16(15(20)5-12)21-7-18(8-21)9-27(25)10-18/h4-5,13H,2-3,6-10H2,1H3/t13-/m0/s1 |
| InChIKey | DOWFPVKSUWWCET-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|