C25H26F2N6O5 — CID 157419259
2-(4-aminophenyl)-7-[2,6-difluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,5]triazepine-1,3-dione (PubChem CID 157419259) has the molecular formula C25H26F2N6O5 and a molecular weight of 528.52 g/mol. Its IUPAC name is 2-(4-aminophenyl)-7-[2,6-difluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,5]triazepine-1,3-dione.
| Compound Name | 2-(4-aminophenyl)-7-[2,6-difluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,5]triazepine-1,3-dione |
|---|---|
| PubChem CID | 157419259 |
| Molecular Formula | C25H26F2N6O5 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-(4-aminophenyl)-7-[2,6-difluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,5]triazepine-1,3-dione |
| SMILES | CC(=O)CC[C@H]1CN(c2cc(F)c(N3CCn4c(=O)n(-c5ccc(N)cc5)c(=O)n4CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H26F2N6O5/c1-15(34)2-7-19-14-30(25(37)38-19)18-12-20(26)22(21(27)13-18)29-8-10-31-23(35)33(24(36)32(31)11-9-29)17-5-3-16(28)4-6-17/h3-6,12-13,19H,2,7-11,14,28H2,1H3/t19-/m0/s1 |
| InChIKey | BPFGCKVNZSNQKA-IBGZPJMESA-N |
| XLogP | 1.88 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|