C18H23F2N3O4 — CID 142669422
(5R)-N-butyl-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 142669422) has the molecular formula C18H23F2N3O4 and a molecular weight of 383.40 g/mol. Its IUPAC name is (5R)-N-butyl-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-N-butyl-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 142669422 |
| Molecular Formula | C18H23F2N3O4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (5R)-N-butyl-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CN(c2cc(F)c(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H23F2N3O4/c1-2-3-4-21-17(24)15-11-23(18(25)27-15)12-9-13(19)16(14(20)10-12)22-5-7-26-8-6-22/h9-10,15H,2-8,11H2,1H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | ATWPVWFVOCQYSF-OAHLLOKOSA-N |
| XLogP | 2.04 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|