C17H20F2N6O2 — CID 68940980
(5S)-5-(aminomethyl)-3-[3,5-difluoro-4-[4-(triazol-2-yl)piperidin-1-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 68940980) has the molecular formula C17H20F2N6O2 and a molecular weight of 378.38 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-3-[3,5-difluoro-4-[4-(triazol-2-yl)piperidin-1-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(aminomethyl)-3-[3,5-difluoro-4-[4-(triazol-2-yl)piperidin-1-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 68940980 |
| Molecular Formula | C17H20F2N6O2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (5S)-5-(aminomethyl)-3-[3,5-difluoro-4-[4-(triazol-2-yl)piperidin-1-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | NC[C@H]1CN(c2cc(F)c(N3CCC(n4nccn4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H20F2N6O2/c18-14-7-12(24-10-13(9-20)27-17(24)26)8-15(19)16(14)23-5-1-11(2-6-23)25-21-3-4-22-25/h3-4,7-8,11,13H,1-2,5-6,9-10,20H2/t13-/m0/s1 |
| InChIKey | GFQPTHKZZDMJHB-ZDUSSCGKSA-N |
| XLogP | 1.68 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|