C12H11ClN2O3S — CID 67131156
(5R)-5-(chloromethyl)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 67131156) has the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. Its IUPAC name is (5R)-5-(chloromethyl)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(chloromethyl)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67131156 |
| Molecular Formula | C12H11ClN2O3S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | (5R)-5-(chloromethyl)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1CSc2ccc(N3C[C@H](CCl)OC3=O)cc2N1 |
| InChI | InChI=1S/C12H11ClN2O3S/c13-4-8-5-15(12(17)18-8)7-1-2-10-9(3-7)14-11(16)6-19-10/h1-3,8H,4-6H2,(H,14,16)/t8-/m0/s1 |
| InChIKey | QTYOLUCKSVICBT-QMMMGPOBSA-N |
| XLogP | 2.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|