C25H25N3O4S — CID 66737478
(5R)-5-[3-[(4-hydroxynaphthalen-1-yl)methylamino]propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 66737478) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is (5R)-5-[3-[(4-hydroxynaphthalen-1-yl)methylamino]propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[3-[(4-hydroxynaphthalen-1-yl)methylamino]propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66737478 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (5R)-5-[3-[(4-hydroxynaphthalen-1-yl)methylamino]propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1CSc2ccc(N3C[C@@H](CCCNCc4ccc(O)c5ccccc45)OC3=O)cc2N1 |
| InChI | InChI=1S/C25H25N3O4S/c29-22-9-7-16(19-5-1-2-6-20(19)22)13-26-11-3-4-18-14-28(25(31)32-18)17-8-10-23-21(12-17)27-24(30)15-33-23/h1-2,5-10,12,18,26,29H,3-4,11,13-15H2,(H,27,30)/t18-/m1/s1 |
| InChIKey | VUGWVSXOUWACPU-GOSISDBHSA-N |
| XLogP | 4.48 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|