C24H24FN5O4S — CID 45279181
(5S)-5-[3-[(7-fluoro-2-methoxyquinoxalin-6-yl)methylamino]propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 45279181) has the molecular formula C24H24FN5O4S and a molecular weight of 497.55 g/mol. Its IUPAC name is (5S)-5-[3-[(7-fluoro-2-methoxyquinoxalin-6-yl)methylamino]propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[3-[(7-fluoro-2-methoxyquinoxalin-6-yl)methylamino]propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 45279181 |
| Molecular Formula | C24H24FN5O4S |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | (5S)-5-[3-[(7-fluoro-2-methoxyquinoxalin-6-yl)methylamino]propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | COc1cnc2cc(CNCCC[C@H]3CN(c4ccc5c(c4)NC(=O)CS5)C(=O)O3)c(F)cc2n1 |
| InChI | InChI=1S/C24H24FN5O4S/c1-33-23-11-27-18-7-14(17(25)9-19(18)29-23)10-26-6-2-3-16-12-30(24(32)34-16)15-4-5-21-20(8-15)28-22(31)13-35-21/h4-5,7-9,11,16,26H,2-3,6,10,12-13H2,1H3,(H,28,31)/t16-/m0/s1 |
| InChIKey | ZHYOFTQIWZUIGU-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|