C14H16N2O3S — CID 123625224
(5S)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-propyl-1,3-oxazolidin-2-one (PubChem CID 123625224) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is (5S)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-propyl-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-propyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123625224 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (5S)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-propyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@H]1CN(c2ccc3c(c2)NC(=O)CS3)C(=O)O1 |
| InChI | InChI=1S/C14H16N2O3S/c1-2-3-10-7-16(14(18)19-10)9-4-5-12-11(6-9)15-13(17)8-20-12/h4-6,10H,2-3,7-8H2,1H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | XFCIRTCBCZVZRC-JTQLQIEISA-N |
| XLogP | 2.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |