C24H24N4O3S — CID 67308495
3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-[2-(2-quinolin-2-ylethylamino)ethyl]-1,3-oxazolidin-2-one (PubChem CID 67308495) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-[2-(2-quinolin-2-ylethylamino)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-[2-(2-quinolin-2-ylethylamino)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67308495 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-[2-(2-quinolin-2-ylethylamino)ethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1CSc2ccc(N3CC(CCNCCc4ccc5ccccc5n4)OC3=O)cc2N1 |
| InChI | InChI=1S/C24H24N4O3S/c29-23-15-32-22-8-7-18(13-21(22)27-23)28-14-19(31-24(28)30)10-12-25-11-9-17-6-5-16-3-1-2-4-20(16)26-17/h1-8,13,19,25H,9-12,14-15H2,(H,27,29) |
| InChIKey | LBFWGVRUZRLEGT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|