C27H27N3O4S — CID 86290510
(5R)-5-[2-[[3-(4-methoxyphenyl)phenyl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 86290510) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is (5R)-5-[2-[[3-(4-methoxyphenyl)phenyl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[2-[[3-(4-methoxyphenyl)phenyl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 86290510 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (5R)-5-[2-[[3-(4-methoxyphenyl)phenyl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(-c2cccc(CNCC[C@@H]3CN(c4ccc5c(c4)NC(=O)CS5)C(=O)O3)c2)cc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-33-22-8-5-19(6-9-22)20-4-2-3-18(13-20)15-28-12-11-23-16-30(27(32)34-23)21-7-10-25-24(14-21)29-26(31)17-35-25/h2-10,13-14,23,28H,11-12,15-17H2,1H3,(H,29,31)/t23-/m1/s1 |
| InChIKey | JWUGLAQHBBEENX-HSZRJFAPSA-N |
| XLogP | 4.91 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|