C25H25N3O3S — CID 66737576
(5S)-5-[3-(naphthalen-1-ylmethylamino)propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 66737576) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is (5S)-5-[3-(naphthalen-1-ylmethylamino)propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[3-(naphthalen-1-ylmethylamino)propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66737576 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (5S)-5-[3-(naphthalen-1-ylmethylamino)propyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1CSc2ccc(N3C[C@H](CCCNCc4cccc5ccccc45)OC3=O)cc2N1 |
| InChI | InChI=1S/C25H25N3O3S/c29-24-16-32-23-11-10-19(13-22(23)27-24)28-15-20(31-25(28)30)8-4-12-26-14-18-7-3-6-17-5-1-2-9-21(17)18/h1-3,5-7,9-11,13,20,26H,4,8,12,14-16H2,(H,27,29)/t20-/m0/s1 |
| InChIKey | CKWUGMZXJQENQY-FQEVSTJZSA-N |
| XLogP | 4.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|