C21H21ClN4O4S — CID 89405764
2-amino-6-chloro-N-[3-[2-oxo-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-5-yl]propyl]benzamide (PubChem CID 89405764) has the molecular formula C21H21ClN4O4S and a molecular weight of 460.94 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[3-[2-oxo-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-5-yl]propyl]benzamide.
| Compound Name | 2-amino-6-chloro-N-[3-[2-oxo-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-5-yl]propyl]benzamide |
|---|---|
| PubChem CID | 89405764 |
| Molecular Formula | C21H21ClN4O4S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-amino-6-chloro-N-[3-[2-oxo-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-5-yl]propyl]benzamide |
| SMILES | Nc1cccc(Cl)c1C(=O)NCCCC1CN(c2ccc3c(c2)NC(=O)CS3)C(=O)O1 |
| InChI | InChI=1S/C21H21ClN4O4S/c22-14-4-1-5-15(23)19(14)20(28)24-8-2-3-13-10-26(21(29)30-13)12-6-7-17-16(9-12)25-18(27)11-31-17/h1,4-7,9,13H,2-3,8,10-11,23H2,(H,24,28)(H,25,27) |
| InChIKey | HQURMIRTIPNRIK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|