C25H25N5O5S — CID 71111314
(5S)-5-[2-[[(9S)-2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 71111314) has the molecular formula C25H25N5O5S and a molecular weight of 507.57 g/mol. Its IUPAC name is (5S)-5-[2-[[(9S)-2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[2-[[(9S)-2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71111314 |
| Molecular Formula | C25H25N5O5S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (5S)-5-[2-[[(9S)-2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc2ncc3c(c2n1)[C@@H](CNCC[C@H]1CN(c2ccc4c(c2)NC(=O)CS4)C(=O)O1)CO3 |
| InChI | InChI=1S/C25H25N5O5S/c1-33-22-5-3-17-24(29-22)23-14(12-34-19(23)10-27-17)9-26-7-6-16-11-30(25(32)35-16)15-2-4-20-18(8-15)28-21(31)13-36-20/h2-5,8,10,14,16,26H,6-7,9,11-13H2,1H3,(H,28,31)/t14-,16-/m0/s1 |
| InChIKey | RBZYBYFLTBIIRQ-HOCLYGCPSA-N |
| XLogP | 3.16 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|