C24H23N5O4S — CID 67350329
(5R)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-[2-[[(3S)-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl]methylamino]ethyl]-1,3-oxazolidin-2-one (PubChem CID 67350329) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is (5R)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-[2-[[(3S)-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl]methylamino]ethyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-[2-[[(3S)-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl]methylamino]ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67350329 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (5R)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-5-[2-[[(3S)-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl]methylamino]ethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1CSc2ccc(N3C[C@@H](CCNC[C@H]4Cn5c(=O)cnc6cccc4c65)OC3=O)cc2N1 |
| InChI | InChI=1S/C24H23N5O4S/c30-21-13-34-20-5-4-15(8-19(20)27-21)28-12-16(33-24(28)32)6-7-25-9-14-11-29-22(31)10-26-18-3-1-2-17(14)23(18)29/h1-5,8,10,14,16,25H,6-7,9,11-13H2,(H,27,30)/t14-,16+/m0/s1 |
| InChIKey | MKQLOLVKCXAWNA-GOEBONIOSA-N |
| XLogP | 2.54 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|