C23H22N6O4S — CID 90149689
(5R)-5-[3-[[(3R)-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl]amino]propyl]-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 90149689) has the molecular formula C23H22N6O4S and a molecular weight of 478.53 g/mol. Its IUPAC name is (5R)-5-[3-[[(3R)-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl]amino]propyl]-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[3-[[(3R)-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl]amino]propyl]-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90149689 |
| Molecular Formula | C23H22N6O4S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (5R)-5-[3-[[(3R)-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl]amino]propyl]-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1CSc2ccc(N3C[C@@H](CCCN[C@H]4Cn5c(=O)cnc6cccc4c65)OC3=O)nc2N1 |
| InChI | InChI=1S/C23H22N6O4S/c30-19-12-34-17-6-7-18(26-22(17)27-19)28-10-13(33-23(28)32)3-2-8-24-16-11-29-20(31)9-25-15-5-1-4-14(16)21(15)29/h1,4-7,9,13,16,24H,2-3,8,10-12H2,(H,26,27,30)/t13-,16+/m1/s1 |
| InChIKey | LKEDXQGBVNQVCT-CJNGLKHVSA-N |
| XLogP | 2.29 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|