C13H13N3O4S — CID 87366957
3-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-1,3-oxazolidin-5-yl]propanal (PubChem CID 87366957) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-1,3-oxazolidin-5-yl]propanal.
| Compound Name | 3-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-1,3-oxazolidin-5-yl]propanal |
|---|---|
| PubChem CID | 87366957 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-1,3-oxazolidin-5-yl]propanal |
| SMILES | O=CCC[C@H]1CN(c2ccc3c(n2)NC(=O)CS3)C(=O)O1 |
| InChI | InChI=1S/C13H13N3O4S/c17-5-1-2-8-6-16(13(19)20-8)10-4-3-9-12(14-10)15-11(18)7-21-9/h3-5,8H,1-2,6-7H2,(H,14,15,18)/t8-/m0/s1 |
| InChIKey | GYQQGBKJWBSTRD-QMMMGPOBSA-N |
| XLogP | 1.43 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|