C25H24N4O5 — CID 67351828
6-[(5S)-2-oxo-5-[2-[(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-1,3-oxazolidin-3-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 67351828) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is 6-[(5S)-2-oxo-5-[2-[(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-1,3-oxazolidin-3-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(5S)-2-oxo-5-[2-[(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-1,3-oxazolidin-3-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 67351828 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 6-[(5S)-2-oxo-5-[2-[(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-1,3-oxazolidin-3-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(N3C[C@H](CCNCC4Cn5c(=O)ccc6cccc4c65)OC3=O)cc2N1 |
| InChI | InChI=1S/C25H24N4O5/c30-22-14-33-21-6-5-17(10-20(21)27-22)28-13-18(34-25(28)32)8-9-26-11-16-12-29-23(31)7-4-15-2-1-3-19(16)24(15)29/h1-7,10,16,18,26H,8-9,11-14H2,(H,27,30)/t16?,18-/m0/s1 |
| InChIKey | IBPBOOUXCJZPLX-DAFXYXGESA-N |
| XLogP | 2.43 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|