C26H26N4O4S — CID 86290587
(5R)-5-[2-[[3-(4-methoxy-2-pyridinyl)phenyl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 86290587) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is (5R)-5-[2-[[3-(4-methoxy-2-pyridinyl)phenyl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[2-[[3-(4-methoxy-2-pyridinyl)phenyl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 86290587 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (5R)-5-[2-[[3-(4-methoxy-2-pyridinyl)phenyl]methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccnc(-c2cccc(CNCC[C@@H]3CN(c4ccc5c(c4)NC(=O)CS5)C(=O)O3)c2)c1 |
| InChI | InChI=1S/C26H26N4O4S/c1-33-20-8-10-28-22(13-20)18-4-2-3-17(11-18)14-27-9-7-21-15-30(26(32)34-21)19-5-6-24-23(12-19)29-25(31)16-35-24/h2-6,8,10-13,21,27H,7,9,14-16H2,1H3,(H,29,31)/t21-/m1/s1 |
| InChIKey | KMFLSVYXZRTXDK-OAQYLSRUSA-N |
| XLogP | 4.31 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|