C11H12BrNO2 — CID 95564147
(5S)-5-(bromomethyl)-3-(4-methylphenyl)-1,3-oxazolidin-2-one (PubChem CID 95564147) has the molecular formula C11H12BrNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is (5S)-5-(bromomethyl)-3-(4-methylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(bromomethyl)-3-(4-methylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 95564147 |
| Molecular Formula | C11H12BrNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | (5S)-5-(bromomethyl)-3-(4-methylphenyl)-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(N2C[C@@H](CBr)OC2=O)cc1 |
| InChI | InChI=1S/C11H12BrNO2/c1-8-2-4-9(5-3-8)13-7-10(6-12)15-11(13)14/h2-5,10H,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | MMKJURFQQNFRMD-SNVBAGLBSA-N |
| XLogP | 2.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|