C16H23N3O2U — CID 23383620
ethyl-[2-[methanidyl-[[3-(4-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]amino]ethyl]azanide;uranium(2+) (PubChem CID 23383620) has the molecular formula C16H23N3O2U and a molecular weight of 527.41 g/mol. Its IUPAC name is ethyl-[2-[methanidyl-[[3-(4-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]amino]ethyl]azanide;uranium(2+).
| Compound Name | ethyl-[2-[methanidyl-[[3-(4-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]amino]ethyl]azanide;uranium(2+) |
|---|---|
| PubChem CID | 23383620 |
| Molecular Formula | C16H23N3O2U |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | ethyl-[2-[methanidyl-[[3-(4-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]amino]ethyl]azanide;uranium(2+) |
| SMILES | [CH2-]N(CC[N-]CC)CC1CN(c2ccc(C)cc2)C(=O)O1.[U+2] |
| InChI | InChI=1S/C16H23N3O2.U/c1-4-17-9-10-18(3)11-15-12-19(16(20)21-15)14-7-5-13(2)6-8-14;/h5-8,15H,3-4,9-12H2,1-2H3;/q-2;+2 |
| InChIKey | NZBJIZZPPMPNDJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|