C16H25N3O2 — CID 23383621
5-[[2-(ethylamino)ethyl-methylamino]methyl]-3-(4-methylphenyl)-1,3-oxazolidin-2-one (PubChem CID 23383621) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 5-[[2-(ethylamino)ethyl-methylamino]methyl]-3-(4-methylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-[[2-(ethylamino)ethyl-methylamino]methyl]-3-(4-methylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23383621 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 5-[[2-(ethylamino)ethyl-methylamino]methyl]-3-(4-methylphenyl)-1,3-oxazolidin-2-one |
| SMILES | CCNCCN(C)CC1CN(c2ccc(C)cc2)C(=O)O1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-17-9-10-18(3)11-15-12-19(16(20)21-15)14-7-5-13(2)6-8-14/h5-8,15,17H,4,9-12H2,1-3H3 |
| InChIKey | YTFMRRFQRMMWCT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|