About [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid)
[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid) (PubChem CID 86755706) has the molecular formula C20H28O9S2
and a molecular weight of 476.57 g/mol. Its IUPAC name is [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid).
Molecular Properties
| Compound Name | [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid) |
| PubChem CID | 86755706 |
| Molecular Formula | C20H28O9S2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid) |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.OC[C@@H]1CC[C@H](CO)O1 |
| InChI | InChI=1S/2C7H8O3S.C6H12O3/c2*1-6-2-4-7(5-3-6)11(8,9)10;7-3-5-1-2-6(4-8)9-5/h2*2-5H,1H3,(H,8,9,10);5-8H,1-4H2/t;;5-,6+ |
| InChIKey | AZMXLICPEDMDGL-IALNUTJISA-N |
| XLogP | 2.00 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid)?
The IUPAC name of [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid) (CID 86755706) is [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid).
What is the SMILES notation for [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid)?
The canonical SMILES for [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid) is Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.OC[C@@H]1CC[C@H](CO)O1.
What is the InChIKey of [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid)?
The InChIKey is AZMXLICPEDMDGL-IALNUTJISA-N. The full InChI is InChI=1S/2C7H8O3S.C6H12O3/c2*1-6-2-4-7(5-3-6)11(8,9)10;7-3-5-1-2-6(4-8)9-5/h2*2-5H,1H3,(H,8,9,10);5-8H,1-4H2/t;;5-,6+.
What are the key properties of [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid)?
[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid) has a molecular weight of 476.57 g/mol, XLogP of 2.00, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methanol;bis(4-methylbenzenesulfonic acid) is sourced from PubChem (CID 86755706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).