C14H16O4S — CID 101229532
[(1R,2S,4S)-3-oxo-2-phenyl-2-bicyclo[2.2.1]heptanyl] methanesulfonate (PubChem CID 101229532) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is [(1R,2S,4S)-3-oxo-2-phenyl-2-bicyclo[2.2.1]heptanyl] methanesulfonate.
| Compound Name | [(1R,2S,4S)-3-oxo-2-phenyl-2-bicyclo[2.2.1]heptanyl] methanesulfonate |
|---|---|
| PubChem CID | 101229532 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [(1R,2S,4S)-3-oxo-2-phenyl-2-bicyclo[2.2.1]heptanyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@]1(c2ccccc2)C(=O)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C14H16O4S/c1-19(16,17)18-14(11-5-3-2-4-6-11)12-8-7-10(9-12)13(14)15/h2-6,10,12H,7-9H2,1H3/t10-,12+,14+/m0/s1 |
| InChIKey | DKOAJAUQLYKTGN-ZKYQVNSYSA-N |
| XLogP | 1.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|