C21H22O — CID 98516588
(1S,4S)-3,3-dibenzylbicyclo[2.2.1]heptan-2-one (PubChem CID 98516588) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is (1S,4S)-3,3-dibenzylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,4S)-3,3-dibenzylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 98516588 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (1S,4S)-3,3-dibenzylbicyclo[2.2.1]heptan-2-one |
| SMILES | O=C1[C@H]2CC[C@@H](C2)C1(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H22O/c22-20-18-11-12-19(13-18)21(20,14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2/t18-,19-/m0/s1 |
| InChIKey | VLKHJAWHRIJHMX-OALUTQOASA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |