C21H22O2 — CID 139040077
(3aR,4R,9aR)-4-benzyl-4-(hydroxymethyl)-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]naphthalen-9-one (PubChem CID 139040077) has the molecular formula C21H22O2 and a molecular weight of 306.40 g/mol. Its IUPAC name is (3aR,4R,9aR)-4-benzyl-4-(hydroxymethyl)-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]naphthalen-9-one.
| Compound Name | (3aR,4R,9aR)-4-benzyl-4-(hydroxymethyl)-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]naphthalen-9-one |
|---|---|
| PubChem CID | 139040077 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3aR,4R,9aR)-4-benzyl-4-(hydroxymethyl)-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]naphthalen-9-one |
| SMILES | O=C1c2ccccc2[C@@](CO)(Cc2ccccc2)[C@@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C21H22O2/c22-14-21(13-15-7-2-1-3-8-15)18-11-5-4-9-16(18)20(23)17-10-6-12-19(17)21/h1-5,7-9,11,17,19,22H,6,10,12-14H2/t17-,19-,21+/m1/s1 |
| InChIKey | ARVCVTFRBWLNMV-QFUCXCTJSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |