C13H14O3 — CID 124707596
(3aS,4R,8bS)-4-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[a]indene-4-carboxylic acid (PubChem CID 124707596) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (3aS,4R,8bS)-4-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[a]indene-4-carboxylic acid.
| Compound Name | (3aS,4R,8bS)-4-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[a]indene-4-carboxylic acid |
|---|---|
| PubChem CID | 124707596 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (3aS,4R,8bS)-4-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[a]indene-4-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)c2ccccc2[C@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C13H14O3/c14-12(15)13(16)10-6-2-1-4-8(10)9-5-3-7-11(9)13/h1-2,4,6,9,11,16H,3,5,7H2,(H,14,15)/t9-,11+,13+/m1/s1 |
| InChIKey | GPCDGCILOWDPBI-CDMKHQONSA-N |
| XLogP | 1.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |