C18H22O4 — CID 132989947
tert-butyl (3aS,9bR)-4-hydroxy-5-oxo-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalene-4-carboxylate (PubChem CID 132989947) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is tert-butyl (3aS,9bR)-4-hydroxy-5-oxo-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalene-4-carboxylate.
| Compound Name | tert-butyl (3aS,9bR)-4-hydroxy-5-oxo-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalene-4-carboxylate |
|---|---|
| PubChem CID | 132989947 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | tert-butyl (3aS,9bR)-4-hydroxy-5-oxo-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(O)C(=O)c2ccccc2[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C18H22O4/c1-17(2,3)22-16(20)18(21)14-10-6-9-12(14)11-7-4-5-8-13(11)15(18)19/h4-5,7-8,12,14,21H,6,9-10H2,1-3H3/t12-,14-,18?/m0/s1 |
| InChIKey | MLZSLXDJTVEWRR-OHASFMIRSA-N |
| XLogP | 2.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|