C18H21BrO4 — CID 132606035
tert-butyl (3aR,4S,9bS)-8-bromo-4-hydroxy-5-oxo-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalene-4-carboxylate (PubChem CID 132606035) has the molecular formula C18H21BrO4 and a molecular weight of 381.27 g/mol. Its IUPAC name is tert-butyl (3aR,4S,9bS)-8-bromo-4-hydroxy-5-oxo-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalene-4-carboxylate.
| Compound Name | tert-butyl (3aR,4S,9bS)-8-bromo-4-hydroxy-5-oxo-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalene-4-carboxylate |
|---|---|
| PubChem CID | 132606035 |
| Molecular Formula | C18H21BrO4 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | tert-butyl (3aR,4S,9bS)-8-bromo-4-hydroxy-5-oxo-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]1(O)C(=O)c2ccc(Br)cc2[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C18H21BrO4/c1-17(2,3)23-16(21)18(22)14-6-4-5-11(14)13-9-10(19)7-8-12(13)15(18)20/h7-9,11,14,22H,4-6H2,1-3H3/t11-,14-,18+/m1/s1 |
| InChIKey | WCEOPWXERBCKCL-OMPKRAJASA-N |
| XLogP | 3.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|