C20H20BrNO3 — CID 131964031
tert-butyl 1-benzyl-6-bromo-3-oxo-1H-isoindole-2-carboxylate (PubChem CID 131964031) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is tert-butyl 1-benzyl-6-bromo-3-oxo-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl 1-benzyl-6-bromo-3-oxo-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 131964031 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | tert-butyl 1-benzyl-6-bromo-3-oxo-1H-isoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)c2ccc(Br)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C20H20BrNO3/c1-20(2,3)25-19(24)22-17(11-13-7-5-4-6-8-13)16-12-14(21)9-10-15(16)18(22)23/h4-10,12,17H,11H2,1-3H3 |
| InChIKey | FSAPWVBSQCVVFI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |