C19H23NO5 — CID 155538449
tert-butyl (2S)-2-benzyl-3-hydroxy-5-oxo-4-propanoyl-2H-pyrrole-1-carboxylate (PubChem CID 155538449) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-benzyl-3-hydroxy-5-oxo-4-propanoyl-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-benzyl-3-hydroxy-5-oxo-4-propanoyl-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 155538449 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | tert-butyl (2S)-2-benzyl-3-hydroxy-5-oxo-4-propanoyl-2H-pyrrole-1-carboxylate |
| SMILES | CCC(=O)C1=C(O)[C@H](Cc2ccccc2)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H23NO5/c1-5-14(21)15-16(22)13(11-12-9-7-6-8-10-12)20(17(15)23)18(24)25-19(2,3)4/h6-10,13,22H,5,11H2,1-4H3/t13-/m0/s1 |
| InChIKey | ALPNZLSYBVNHOD-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|