C19H23FN2O6 — CID 102237352
tert-butyl 5-benzyl-3-(2-ethoxy-1-fluoro-2-oxoethyl)-2,4-dioxoimidazolidine-1-carboxylate (PubChem CID 102237352) has the molecular formula C19H23FN2O6 and a molecular weight of 394.40 g/mol. Its IUPAC name is tert-butyl 5-benzyl-3-(2-ethoxy-1-fluoro-2-oxoethyl)-2,4-dioxoimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 5-benzyl-3-(2-ethoxy-1-fluoro-2-oxoethyl)-2,4-dioxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 102237352 |
| Molecular Formula | C19H23FN2O6 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | tert-butyl 5-benzyl-3-(2-ethoxy-1-fluoro-2-oxoethyl)-2,4-dioxoimidazolidine-1-carboxylate |
| SMILES | CCOC(=O)C(F)N1C(=O)C(Cc2ccccc2)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H23FN2O6/c1-5-27-16(24)14(20)22-15(23)13(11-12-9-7-6-8-10-12)21(17(22)25)18(26)28-19(2,3)4/h6-10,13-14H,5,11H2,1-4H3 |
| InChIKey | PKLRFKBVRGDBJD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|