C20H25FN2O6 — CID 101045343
tert-butyl 3-[1-fluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,4-dioxo-5-phenylimidazolidine-1-carboxylate (PubChem CID 101045343) has the molecular formula C20H25FN2O6 and a molecular weight of 408.43 g/mol. Its IUPAC name is tert-butyl 3-[1-fluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,4-dioxo-5-phenylimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-fluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,4-dioxo-5-phenylimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 101045343 |
| Molecular Formula | C20H25FN2O6 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | tert-butyl 3-[1-fluoro-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,4-dioxo-5-phenylimidazolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C(F)N1C(=O)C(c2ccccc2)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C20H25FN2O6/c1-19(2,3)28-16(25)14(21)23-15(24)13(12-10-8-7-9-11-12)22(17(23)26)18(27)29-20(4,5)6/h7-11,13-14H,1-6H3 |
| InChIKey | LVTBZQFKCCWOAE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|