C20H25NO2Si — CID 156629327
tert-butyl 3,3-dimethyl-2-phenyl-2H-1,3-benzazasilole-1-carboxylate (PubChem CID 156629327) has the molecular formula C20H25NO2Si and a molecular weight of 339.51 g/mol. Its IUPAC name is tert-butyl 3,3-dimethyl-2-phenyl-2H-1,3-benzazasilole-1-carboxylate.
| Compound Name | tert-butyl 3,3-dimethyl-2-phenyl-2H-1,3-benzazasilole-1-carboxylate |
|---|---|
| PubChem CID | 156629327 |
| Molecular Formula | C20H25NO2Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | tert-butyl 3,3-dimethyl-2-phenyl-2H-1,3-benzazasilole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2[Si](C)(C)C1c1ccccc1 |
| InChI | InChI=1S/C20H25NO2Si/c1-20(2,3)23-19(22)21-16-13-9-10-14-17(16)24(4,5)18(21)15-11-7-6-8-12-15/h6-14,18H,1-5H3 |
| InChIKey | LOBOMFMQAJGGQZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|