C19H20FNO2 — CID 11681181
tert-butyl (2S)-2-(4-fluorophenyl)-2,3-dihydroindole-1-carboxylate (PubChem CID 11681181) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-(4-fluorophenyl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(4-fluorophenyl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 11681181 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl (2S)-2-(4-fluorophenyl)-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO2/c1-19(2,3)23-18(22)21-16-7-5-4-6-14(16)12-17(21)13-8-10-15(20)11-9-13/h4-11,17H,12H2,1-3H3/t17-/m0/s1 |
| InChIKey | JYMSEERYLKYTLF-KRWDZBQOSA-N |
| XLogP | 4.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |