C20H20FNO3 — CID 71661820
tert-butyl 2-benzoyl-6-fluoro-2,3-dihydroindole-1-carboxylate (PubChem CID 71661820) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is tert-butyl 2-benzoyl-6-fluoro-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 2-benzoyl-6-fluoro-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 71661820 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl 2-benzoyl-6-fluoro-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2cc(F)ccc2CC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20FNO3/c1-20(2,3)25-19(24)22-16-12-15(21)10-9-14(16)11-17(22)18(23)13-7-5-4-6-8-13/h4-10,12,17H,11H2,1-3H3 |
| InChIKey | KCLHPABSRMFPIX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |