C18H21FN2O6 — CID 11440384
tert-butyl 3-(2-ethoxy-1-fluoro-2-oxoethyl)-2,4-dioxo-5-phenylimidazolidine-1-carboxylate (PubChem CID 11440384) has the molecular formula C18H21FN2O6 and a molecular weight of 380.37 g/mol. Its IUPAC name is tert-butyl 3-(2-ethoxy-1-fluoro-2-oxoethyl)-2,4-dioxo-5-phenylimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-ethoxy-1-fluoro-2-oxoethyl)-2,4-dioxo-5-phenylimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 11440384 |
| Molecular Formula | C18H21FN2O6 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | tert-butyl 3-(2-ethoxy-1-fluoro-2-oxoethyl)-2,4-dioxo-5-phenylimidazolidine-1-carboxylate |
| SMILES | CCOC(=O)C(F)N1C(=O)C(c2ccccc2)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C18H21FN2O6/c1-5-26-15(23)13(19)21-14(22)12(11-9-7-6-8-10-11)20(16(21)24)17(25)27-18(2,3)4/h6-10,12-13H,5H2,1-4H3 |
| InChIKey | GURVXGQWYGPCCJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|