C13H13FN2O4 — CID 101045340
ethyl 2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-2-fluoroacetate (PubChem CID 101045340) has the molecular formula C13H13FN2O4 and a molecular weight of 280.26 g/mol. Its IUPAC name is ethyl 2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-2-fluoroacetate.
| Compound Name | ethyl 2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-2-fluoroacetate |
|---|---|
| PubChem CID | 101045340 |
| Molecular Formula | C13H13FN2O4 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl 2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)N1C(=O)NC(c2ccccc2)C1=O |
| InChI | InChI=1S/C13H13FN2O4/c1-2-20-12(18)10(14)16-11(17)9(15-13(16)19)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3,(H,15,19) |
| InChIKey | DJIBJKDLMLEFPR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|