C11H13ClN2O2 — CID 140541909
3-ethyl-5-phenylimidazolidine-2,4-dione;hydrochloride (PubChem CID 140541909) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 3-ethyl-5-phenylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-ethyl-5-phenylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 140541909 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-ethyl-5-phenylimidazolidine-2,4-dione;hydrochloride |
| SMILES | CCN1C(=O)NC(c2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C11H12N2O2.ClH/c1-2-13-10(14)9(12-11(13)15)8-6-4-3-5-7-8;/h3-7,9H,2H2,1H3,(H,12,15);1H |
| InChIKey | MQFUGLQLKZOXJL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|