C15H18N2O4 — CID 125482450
tert-butyl 2-[(4R)-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate (PubChem CID 125482450) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is tert-butyl 2-[(4R)-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(4R)-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 125482450 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | tert-butyl 2-[(4R)-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)N[C@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,3)21-11(18)9-17-13(19)12(16-14(17)20)10-7-5-4-6-8-10/h4-8,12H,9H2,1-3H3,(H,16,20)/t12-/m1/s1 |
| InChIKey | LYHMOFACRDAQTP-GFCCVEGCSA-N |
| XLogP | 1.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|