C22H24BrNO3 — CID 10477770
tert-butyl 2-[(3S,5R)-3-bromo-2-oxo-5-phenyl-4,5-dihydro-3H-1-benzazepin-1-yl]acetate (PubChem CID 10477770) has the molecular formula C22H24BrNO3 and a molecular weight of 430.34 g/mol. Its IUPAC name is tert-butyl 2-[(3S,5R)-3-bromo-2-oxo-5-phenyl-4,5-dihydro-3H-1-benzazepin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,5R)-3-bromo-2-oxo-5-phenyl-4,5-dihydro-3H-1-benzazepin-1-yl]acetate |
|---|---|
| PubChem CID | 10477770 |
| Molecular Formula | C22H24BrNO3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | tert-butyl 2-[(3S,5R)-3-bromo-2-oxo-5-phenyl-4,5-dihydro-3H-1-benzazepin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)[C@@H](Br)C[C@H](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H24BrNO3/c1-22(2,3)27-20(25)14-24-19-12-8-7-11-16(19)17(13-18(23)21(24)26)15-9-5-4-6-10-15/h4-12,17-18H,13-14H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | DRKBIFBRAATPEL-MSOLQXFVSA-N |
| XLogP | 4.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|