C14H17N3O4 — CID 125482513
tert-butyl 2-[(4S)-2,5-dioxo-4-pyridin-3-ylimidazolidin-1-yl]acetate (PubChem CID 125482513) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is tert-butyl 2-[(4S)-2,5-dioxo-4-pyridin-3-ylimidazolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(4S)-2,5-dioxo-4-pyridin-3-ylimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 125482513 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | tert-butyl 2-[(4S)-2,5-dioxo-4-pyridin-3-ylimidazolidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)N[C@@H](c2cccnc2)C1=O |
| InChI | InChI=1S/C14H17N3O4/c1-14(2,3)21-10(18)8-17-12(19)11(16-13(17)20)9-5-4-6-15-7-9/h4-7,11H,8H2,1-3H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | YQJANXGRFQVOAE-NSHDSACASA-N |
| XLogP | 1.02 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|