C25H29BrN2O2 — CID 10367394
2-[(3S,5R)-3-bromo-2-oxo-5-phenyl-4,5-dihydro-3H-1-benzazepin-1-yl]-N-(1-methylcyclohexyl)acetamide (PubChem CID 10367394) has the molecular formula C25H29BrN2O2 and a molecular weight of 469.42 g/mol. Its IUPAC name is 2-[(3S,5R)-3-bromo-2-oxo-5-phenyl-4,5-dihydro-3H-1-benzazepin-1-yl]-N-(1-methylcyclohexyl)acetamide.
| Compound Name | 2-[(3S,5R)-3-bromo-2-oxo-5-phenyl-4,5-dihydro-3H-1-benzazepin-1-yl]-N-(1-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 10367394 |
| Molecular Formula | C25H29BrN2O2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-[(3S,5R)-3-bromo-2-oxo-5-phenyl-4,5-dihydro-3H-1-benzazepin-1-yl]-N-(1-methylcyclohexyl)acetamide |
| SMILES | CC1(NC(=O)CN2C(=O)[C@@H](Br)C[C@H](c3ccccc3)c3ccccc32)CCCCC1 |
| InChI | InChI=1S/C25H29BrN2O2/c1-25(14-8-3-9-15-25)27-23(29)17-28-22-13-7-6-12-19(22)20(16-21(26)24(28)30)18-10-4-2-5-11-18/h2,4-7,10-13,20-21H,3,8-9,14-17H2,1H3,(H,27,29)/t20-,21+/m1/s1 |
| InChIKey | IXMRDYZDQNFXHH-RTWAWAEBSA-N |
| XLogP | 5.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|