C20H30N2O3 — CID 71032139
tert-butyl 2-[(3S,7S)-3-(ethylamino)-2-oxo-7-phenylazepan-1-yl]acetate (PubChem CID 71032139) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl 2-[(3S,7S)-3-(ethylamino)-2-oxo-7-phenylazepan-1-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,7S)-3-(ethylamino)-2-oxo-7-phenylazepan-1-yl]acetate |
|---|---|
| PubChem CID | 71032139 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl 2-[(3S,7S)-3-(ethylamino)-2-oxo-7-phenylazepan-1-yl]acetate |
| SMILES | CCN[C@H]1CCC[C@@H](c2ccccc2)N(CC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C20H30N2O3/c1-5-21-16-12-9-13-17(15-10-7-6-8-11-15)22(19(16)24)14-18(23)25-20(2,3)4/h6-8,10-11,16-17,21H,5,9,12-14H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | AASIGWZUSYOSMT-IRXDYDNUSA-N |
| XLogP | 3.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |