C27H40N2O5 — CID 67866234
ethyl (2S)-2-[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-oxo-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-3-yl]amino]-4-phenylbutanoate (PubChem CID 67866234) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is ethyl (2S)-2-[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-oxo-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-3-yl]amino]-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-oxo-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-3-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 67866234 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | ethyl (2S)-2-[[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-oxo-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-3-yl]amino]-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)NC1CCC2CCCC2N(CC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C27H40N2O5/c1-5-33-26(32)22(16-14-19-10-7-6-8-11-19)28-21-17-15-20-12-9-13-23(20)29(25(21)31)18-24(30)34-27(2,3)4/h6-8,10-11,20-23,28H,5,9,12-18H2,1-4H3/t20?,21?,22-,23?/m0/s1 |
| InChIKey | JJYNUBLHEYUHAG-VPMYNCEMSA-N |
| XLogP | 3.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |