C24H36N2O5 — CID 23322753
ethyl 2-[[1-(2-ethoxy-2-oxoethyl)-2-oxoazonan-3-yl]amino]-4-phenylbutanoate (PubChem CID 23322753) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is ethyl 2-[[1-(2-ethoxy-2-oxoethyl)-2-oxoazonan-3-yl]amino]-4-phenylbutanoate.
| Compound Name | ethyl 2-[[1-(2-ethoxy-2-oxoethyl)-2-oxoazonan-3-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 23322753 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | ethyl 2-[[1-(2-ethoxy-2-oxoethyl)-2-oxoazonan-3-yl]amino]-4-phenylbutanoate |
| SMILES | CCOC(=O)CN1CCCCCCC(NC(CCc2ccccc2)C(=O)OCC)C1=O |
| InChI | InChI=1S/C24H36N2O5/c1-3-30-22(27)18-26-17-11-6-5-10-14-20(23(26)28)25-21(24(29)31-4-2)16-15-19-12-8-7-9-13-19/h7-9,12-13,20-21,25H,3-6,10-11,14-18H2,1-2H3 |
| InChIKey | SEZXEXUHFPSDIF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |