C26H32N2O5 — CID 54440962
2-[[2-oxo-1-(3-oxo-3-phenylmethoxypropyl)azepan-3-yl]amino]-4-phenylbutanoic acid (PubChem CID 54440962) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-[[2-oxo-1-(3-oxo-3-phenylmethoxypropyl)azepan-3-yl]amino]-4-phenylbutanoic acid.
| Compound Name | 2-[[2-oxo-1-(3-oxo-3-phenylmethoxypropyl)azepan-3-yl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 54440962 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[[2-oxo-1-(3-oxo-3-phenylmethoxypropyl)azepan-3-yl]amino]-4-phenylbutanoic acid |
| SMILES | O=C(CCN1CCCCC(NC(CCc2ccccc2)C(=O)O)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H32N2O5/c29-24(33-19-21-11-5-2-6-12-21)16-18-28-17-8-7-13-22(25(28)30)27-23(26(31)32)15-14-20-9-3-1-4-10-20/h1-6,9-12,22-23,27H,7-8,13-19H2,(H,31,32) |
| InChIKey | WOBBPFOTEAAGOB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |