C18H24N2O4S — CID 57132142
3-[(3S)-2-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]propanoic acid (PubChem CID 57132142) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-[(3S)-2-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]propanoic acid.
| Compound Name | 3-[(3S)-2-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]propanoic acid |
|---|---|
| PubChem CID | 57132142 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-[(3S)-2-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCCC[C@H](NC(=O)[C@H](S)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H24N2O4S/c21-16(22)9-11-20-10-5-4-8-14(18(20)24)19-17(23)15(25)12-13-6-2-1-3-7-13/h1-3,6-7,14-15,25H,4-5,8-12H2,(H,19,23)(H,21,22)/t14-,15+/m0/s1 |
| InChIKey | FGIMVVAISMSURO-LSDHHAIUSA-N |
| XLogP | 1.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|