C11H12N4O3 — CID 84571871
2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetohydrazide (PubChem CID 84571871) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetohydrazide.
| Compound Name | 2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 84571871 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetohydrazide |
| SMILES | NNC(=O)CN1C(=O)NC(c2ccccc2)C1=O |
| InChI | InChI=1S/C11H12N4O3/c12-14-8(16)6-15-10(17)9(13-11(15)18)7-4-2-1-3-5-7/h1-5,9H,6,12H2,(H,13,18)(H,14,16) |
| InChIKey | FULFAEHMSOOYQY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|